C13H21N5O2 — CID 73328329
3-methyl-7-propyl-8-pyrrolidin-1-yl-4,5-dihydropurine-2,6-dione (PubChem CID 73328329) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-methyl-7-propyl-8-pyrrolidin-1-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-7-propyl-8-pyrrolidin-1-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 73328329 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-methyl-7-propyl-8-pyrrolidin-1-yl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCN1C(N2CCCC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C13H21N5O2/c1-3-6-18-9-10(16(2)13(20)15-11(9)19)14-12(18)17-7-4-5-8-17/h9-10H,3-8H2,1-2H3,(H,15,19,20) |
| InChIKey | BTZFIEDXWOZUBU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |