C26H38N2O4S — CID 73332231
ethyl (1R,2R,3'R,4'R,5'S)-1-[[(R)-tert-butylsulfinyl]amino]-6-cyano-3'-ethyl-4'-methoxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (PubChem CID 73332231) has the molecular formula C26H38N2O4S and a molecular weight of 474.67 g/mol. Its IUPAC name is ethyl (1R,2R,3'R,4'R,5'S)-1-[[(R)-tert-butylsulfinyl]amino]-6-cyano-3'-ethyl-4'-methoxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
| Compound Name | ethyl (1R,2R,3'R,4'R,5'S)-1-[[(R)-tert-butylsulfinyl]amino]-6-cyano-3'-ethyl-4'-methoxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
|---|---|
| PubChem CID | 73332231 |
| Molecular Formula | C26H38N2O4S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | ethyl (1R,2R,3'R,4'R,5'S)-1-[[(R)-tert-butylsulfinyl]amino]-6-cyano-3'-ethyl-4'-methoxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(N[S@](=O)C(C)(C)C)c2cc(C#N)ccc2C[C@@]12C[C@@H](CC)[C@H](OC)[C@@H](C)C2 |
| InChI | InChI=1S/C26H38N2O4S/c1-8-19-14-25(13-17(3)22(19)31-7)15-20-11-10-18(16-27)12-21(20)26(25,23(29)32-9-2)28-33(30)24(4,5)6/h10-12,17,19,22,28H,8-9,13-15H2,1-7H3/t17-,19+,22+,25+,26+,33+/m0/s1 |
| InChIKey | ZTBCCTCDUOOUHJ-CUMZLISHSA-N |
| XLogP | 4.38 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |