C24H27IN2S — CID 73334965
(2R,5S)-1-[(3-iodophenyl)methyl]-2,5-dimethyl-4-[(S)-phenyl(thiophen-3-yl)methyl]piperazine (PubChem CID 73334965) has the molecular formula C24H27IN2S and a molecular weight of 502.47 g/mol. Its IUPAC name is (2R,5S)-1-[(3-iodophenyl)methyl]-2,5-dimethyl-4-[(S)-phenyl(thiophen-3-yl)methyl]piperazine.
| Compound Name | (2R,5S)-1-[(3-iodophenyl)methyl]-2,5-dimethyl-4-[(S)-phenyl(thiophen-3-yl)methyl]piperazine |
|---|---|
| PubChem CID | 73334965 |
| Molecular Formula | C24H27IN2S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | (2R,5S)-1-[(3-iodophenyl)methyl]-2,5-dimethyl-4-[(S)-phenyl(thiophen-3-yl)methyl]piperazine |
| SMILES | C[C@@H]1CN(C(c2ccccc2)c2ccsc2)[C@@H](C)CN1Cc1cccc(I)c1 |
| InChI | InChI=1S/C24H27IN2S/c1-18-15-27(19(2)14-26(18)16-20-7-6-10-23(25)13-20)24(22-11-12-28-17-22)21-8-4-3-5-9-21/h3-13,17-19,24H,14-16H2,1-2H3/t18-,19+,24?/m1/s1 |
| InChIKey | HMKMZTPFURXVAF-WEAPTXNRSA-N |
| XLogP | 6.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|