C22H32N2O10S — CID 73354985
5-[(2S,4R)-4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione (PubChem CID 73354985) has the molecular formula C22H32N2O10S and a molecular weight of 516.57 g/mol. Its IUPAC name is 5-[(2S,4R)-4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione.
| Compound Name | 5-[(2S,4R)-4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 73354985 |
| Molecular Formula | C22H32N2O10S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 5-[(2S,4R)-4-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1H-indole-2,3-dione |
| SMILES | COC[C@@H]1C[C@@H](OCCOCCOCCOCCO)CN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C22H32N2O10S/c1-30-15-16-12-17(34-11-10-33-9-8-32-7-6-31-5-4-25)14-24(16)35(28,29)18-2-3-20-19(13-18)21(26)22(27)23-20/h2-3,13,16-17,25H,4-12,14-15H2,1H3,(H,23,26,27)/t16-,17+/m0/s1 |
| InChIKey | LFWWHMQTYPOGNR-DLBZAZTESA-N |
| XLogP | -0.34 |
| TPSA | 149.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|