C28H27NO2 — CID 7336270
(1R,6S,7R)-3,3-dimethyl-7,9-diphenyl-4,17-dioxa-10-azatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,13,15-tetraene (PubChem CID 7336270) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (1R,6S,7R)-3,3-dimethyl-7,9-diphenyl-4,17-dioxa-10-azatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,13,15-tetraene.
| Compound Name | (1R,6S,7R)-3,3-dimethyl-7,9-diphenyl-4,17-dioxa-10-azatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,13,15-tetraene |
|---|---|
| PubChem CID | 7336270 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (1R,6S,7R)-3,3-dimethyl-7,9-diphenyl-4,17-dioxa-10-azatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,13,15-tetraene |
| SMILES | CC1(C)C[C@]23Oc4ccccc4N2C(c2ccccc2)=C[C@@H](c2ccccc2)[C@H]3CO1 |
| InChI | InChI=1S/C28H27NO2/c1-27(2)19-28-23(18-30-27)22(20-11-5-3-6-12-20)17-25(21-13-7-4-8-14-21)29(28)24-15-9-10-16-26(24)31-28/h3-17,22-23H,18-19H2,1-2H3/t22-,23+,28+/m0/s1 |
| InChIKey | FVYWBKDBHKJWES-SXDGJLEOSA-N |
| XLogP | 6.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |