C27H24N2O — CID 7075427
(1R,6R,7R)-7,9-diphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-one (PubChem CID 7075427) has the molecular formula C27H24N2O and a molecular weight of 392.50 g/mol. Its IUPAC name is (1R,6R,7R)-7,9-diphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-one.
| Compound Name | (1R,6R,7R)-7,9-diphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-one |
|---|---|
| PubChem CID | 7075427 |
| Molecular Formula | C27H24N2O |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (1R,6R,7R)-7,9-diphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-one |
| SMILES | O=C1C=CC2=N[C@]34CCCC[C@@H]3[C@H](c3ccccc3)C=C(c3ccccc3)N4C2=C1 |
| InChI | InChI=1S/C27H24N2O/c30-21-14-15-24-26(17-21)29-25(20-11-5-2-6-12-20)18-22(19-9-3-1-4-10-19)23-13-7-8-16-27(23,29)28-24/h1-6,9-12,14-15,17-18,22-23H,7-8,13,16H2/t22-,23+,27-/m0/s1 |
| InChIKey | LHJUMCYFYYQTPP-OBTVHEKISA-N |
| XLogP | 5.49 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|