C31H26N2O — CID 40995067
(1R,16R,17R)-14,16-diphenyl-2,13-diazapentacyclo[11.8.0.01,17.03,12.04,9]henicosa-2,4,6,8,11,14-hexaen-10-one (PubChem CID 40995067) has the molecular formula C31H26N2O and a molecular weight of 442.56 g/mol. Its IUPAC name is (1R,16R,17R)-14,16-diphenyl-2,13-diazapentacyclo[11.8.0.01,17.03,12.04,9]henicosa-2,4,6,8,11,14-hexaen-10-one.
| Compound Name | (1R,16R,17R)-14,16-diphenyl-2,13-diazapentacyclo[11.8.0.01,17.03,12.04,9]henicosa-2,4,6,8,11,14-hexaen-10-one |
|---|---|
| PubChem CID | 40995067 |
| Molecular Formula | C31H26N2O |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (1R,16R,17R)-14,16-diphenyl-2,13-diazapentacyclo[11.8.0.01,17.03,12.04,9]henicosa-2,4,6,8,11,14-hexaen-10-one |
| SMILES | O=C1C=C2C(=N[C@]34CCCC[C@@H]3[C@H](c3ccccc3)C=C(c3ccccc3)N24)c2ccccc21 |
| InChI | InChI=1S/C31H26N2O/c34-29-20-28-30(24-16-8-7-15-23(24)29)32-31-18-10-9-17-26(31)25(21-11-3-1-4-12-21)19-27(33(28)31)22-13-5-2-6-14-22/h1-8,11-16,19-20,25-26H,9-10,17-18H2/t25-,26+,31-/m0/s1 |
| InChIKey | WCSNDIBBXOJAOR-HEHLMWRFSA-N |
| XLogP | 6.60 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|