C34H26N4 — CID 94908995
2-[(1S,16R,17R)-14,16-diphenyl-2,13-diazapentacyclo[11.8.0.01,17.03,12.04,9]henicosa-2,4,6,8,11,14-hexaen-10-ylidene]propanedinitrile (PubChem CID 94908995) has the molecular formula C34H26N4 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[(1S,16R,17R)-14,16-diphenyl-2,13-diazapentacyclo[11.8.0.01,17.03,12.04,9]henicosa-2,4,6,8,11,14-hexaen-10-ylidene]propanedinitrile.
| Compound Name | 2-[(1S,16R,17R)-14,16-diphenyl-2,13-diazapentacyclo[11.8.0.01,17.03,12.04,9]henicosa-2,4,6,8,11,14-hexaen-10-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 94908995 |
| Molecular Formula | C34H26N4 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-[(1S,16R,17R)-14,16-diphenyl-2,13-diazapentacyclo[11.8.0.01,17.03,12.04,9]henicosa-2,4,6,8,11,14-hexaen-10-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=c1cc2c(c3ccccc13)=N[C@@]13CCCC[C@@H]1[C@H](c1ccccc1)C=C(c1ccccc1)N23 |
| InChI | InChI=1S/C34H26N4/c35-21-25(22-36)28-19-32-33(27-16-8-7-15-26(27)28)37-34-18-10-9-17-30(34)29(23-11-3-1-4-12-23)20-31(38(32)34)24-13-5-2-6-14-24/h1-8,11-16,19-20,29-30H,9-10,17-18H2/t29-,30+,34+/m0/s1 |
| InChIKey | SOSSTXKLKWXPIT-YIQDYSAESA-N |
| XLogP | 6.20 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |