C21H22S2 — CID 11869864
(4R,4aR,8aS)-2,4-diphenyl-4,4a,5,6,7,8-hexahydrothiochromene-8a-thiol (PubChem CID 11869864) has the molecular formula C21H22S2 and a molecular weight of 338.54 g/mol. Its IUPAC name is (4R,4aR,8aS)-2,4-diphenyl-4,4a,5,6,7,8-hexahydrothiochromene-8a-thiol.
| Compound Name | (4R,4aR,8aS)-2,4-diphenyl-4,4a,5,6,7,8-hexahydrothiochromene-8a-thiol |
|---|---|
| PubChem CID | 11869864 |
| Molecular Formula | C21H22S2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (4R,4aR,8aS)-2,4-diphenyl-4,4a,5,6,7,8-hexahydrothiochromene-8a-thiol |
| SMILES | S[C@]12CCCC[C@@H]1[C@H](c1ccccc1)C=C(c1ccccc1)S2 |
| InChI | InChI=1S/C21H22S2/c22-21-14-8-7-13-19(21)18(16-9-3-1-4-10-16)15-20(23-21)17-11-5-2-6-12-17/h1-6,9-12,15,18-19,22H,7-8,13-14H2/t18-,19+,21-/m0/s1 |
| InChIKey | NHPGGMMMZYRZIW-ZVDOUQERSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|