C33H29N3 — CID 94903616
(1S,6R,7R)-N,7,9-triphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-imine (PubChem CID 94903616) has the molecular formula C33H29N3 and a molecular weight of 467.62 g/mol. Its IUPAC name is (1S,6R,7R)-N,7,9-triphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-imine.
| Compound Name | (1S,6R,7R)-N,7,9-triphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-imine |
|---|---|
| PubChem CID | 94903616 |
| Molecular Formula | C33H29N3 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | (1S,6R,7R)-N,7,9-triphenyl-10,17-diazatetracyclo[8.7.0.01,6.011,16]heptadeca-8,11,14,16-tetraen-13-imine |
| SMILES | C1=C/C(=N\c2ccccc2)C=C2C1=N[C@@]13CCCC[C@@H]1[C@H](c1ccccc1)C=C(c1ccccc1)N23 |
| InChI | InChI=1S/C33H29N3/c1-4-12-24(13-5-1)28-23-31(25-14-6-2-7-15-25)36-32-22-27(34-26-16-8-3-9-17-26)19-20-30(32)35-33(36)21-11-10-18-29(28)33/h1-9,12-17,19-20,22-23,28-29H,10-11,18,21H2/b34-27+/t28-,29+,33+/m0/s1 |
| InChIKey | ORCOQVONIHTFKF-JDZLXOADSA-N |
| XLogP | 7.69 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|