C25H33N3 — CID 6580318
(1S,6R)-N-cyclohexyl-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-imine (PubChem CID 6580318) has the molecular formula C25H33N3 and a molecular weight of 375.56 g/mol. Its IUPAC name is (1S,6R)-N-cyclohexyl-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-imine.
| Compound Name | (1S,6R)-N-cyclohexyl-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-imine |
|---|---|
| PubChem CID | 6580318 |
| Molecular Formula | C25H33N3 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | (1S,6R)-N-cyclohexyl-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-imine |
| SMILES | C1=C/C(=N\C2CCCCC2)C=C2C1=N[C@@]13CCCC[C@@H]1CC1=C(CCCC1)N23 |
| InChI | InChI=1S/C25H33N3/c1-2-10-20(11-3-1)26-21-13-14-22-24(17-21)28-23-12-5-4-8-18(23)16-19-9-6-7-15-25(19,28)27-22/h13-14,17,19-20H,1-12,15-16H2/b26-21+/t19-,25-/m1/s1 |
| InChIKey | SVPQRBCSONEAHF-QINANHJXSA-N |
| XLogP | 6.09 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|