C23H29N3O — CID 12024787
19,19-dimethyl-21-oxa-14,18,25-triazahexacyclo[12.11.0.01,6.08,13.015,24.017,22]pentacosa-8(13),15,17,22,24-pentaene (PubChem CID 12024787) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 19,19-dimethyl-21-oxa-14,18,25-triazahexacyclo[12.11.0.01,6.08,13.015,24.017,22]pentacosa-8(13),15,17,22,24-pentaene.
| Compound Name | 19,19-dimethyl-21-oxa-14,18,25-triazahexacyclo[12.11.0.01,6.08,13.015,24.017,22]pentacosa-8(13),15,17,22,24-pentaene |
|---|---|
| PubChem CID | 12024787 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 19,19-dimethyl-21-oxa-14,18,25-triazahexacyclo[12.11.0.01,6.08,13.015,24.017,22]pentacosa-8(13),15,17,22,24-pentaene |
| SMILES | CC1(C)COc2cc3c(cc2=N1)N1C2=C(CCCC2)CC2CCCCC21N=3 |
| InChI | InChI=1S/C23H29N3O/c1-22(2)14-27-21-13-17-20(12-18(21)24-22)26-19-9-4-3-7-15(19)11-16-8-5-6-10-23(16,26)25-17/h12-13,16H,3-11,14H2,1-2H3 |
| InChIKey | UCPCUUMFTNBXGX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|