C20H22N4 — CID 7351101
[(1R,6R)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-ylidene]cyanamide (PubChem CID 7351101) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is [(1R,6R)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-ylidene]cyanamide.
| Compound Name | [(1R,6R)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-ylidene]cyanamide |
|---|---|
| PubChem CID | 7351101 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [(1R,6R)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-ylidene]cyanamide |
| SMILES | N#C/N=C1\C=CC2=N[C@]34CCCC[C@@H]3CC3=C(CCCC3)N4C2=C1 |
| InChI | InChI=1S/C20H22N4/c21-13-22-16-8-9-17-19(12-16)24-18-7-2-1-5-14(18)11-15-6-3-4-10-20(15,24)23-17/h8-9,12,15H,1-7,10-11H2/b22-16+/t15-,20+/m1/s1 |
| InChIKey | PGIOSDTXXXXKEC-HJUQSYIRSA-N |
| XLogP | 4.24 |
| TPSA | 51.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|