C19H22N2O — CID 927529
(1S,6R)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-one (PubChem CID 927529) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (1S,6R)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-one.
| Compound Name | (1S,6R)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-one |
|---|---|
| PubChem CID | 927529 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (1S,6R)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,18,20-tetraen-17-one |
| SMILES | O=C1C=CC2=N[C@@]34CCCC[C@@H]3CC3=C(CCCC3)N4C2=C1 |
| InChI | InChI=1S/C19H22N2O/c22-15-8-9-16-18(12-15)21-17-7-2-1-5-13(17)11-14-6-3-4-10-19(14,21)20-16/h8-9,12,14H,1-7,10-11H2/t14-,19-/m1/s1 |
| InChIKey | DDBSWDOVRIISKC-AUUYWEPGSA-N |
| XLogP | 3.88 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|