C23H18N2O — CID 919349
(4aS)-1,4a-diphenyl-3,4-dihydropyrido[1,2-a]benzimidazol-8-one (PubChem CID 919349) has the molecular formula C23H18N2O and a molecular weight of 338.41 g/mol. Its IUPAC name is (4aS)-1,4a-diphenyl-3,4-dihydropyrido[1,2-a]benzimidazol-8-one.
| Compound Name | (4aS)-1,4a-diphenyl-3,4-dihydropyrido[1,2-a]benzimidazol-8-one |
|---|---|
| PubChem CID | 919349 |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (4aS)-1,4a-diphenyl-3,4-dihydropyrido[1,2-a]benzimidazol-8-one |
| SMILES | O=C1C=CC2=N[C@]3(c4ccccc4)CCC=C(c4ccccc4)N3C2=C1 |
| InChI | InChI=1S/C23H18N2O/c26-19-13-14-20-22(16-19)25-21(17-8-3-1-4-9-17)12-7-15-23(25,24-20)18-10-5-2-6-11-18/h1-6,8-14,16H,7,15H2/t23-/m1/s1 |
| InChIKey | FUFIYGWTSAIFHZ-HSZRJFAPSA-N |
| XLogP | 4.45 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|