C17H20O — CID 175208692
2,2-dimethyl-3-(6-phenylcyclohexa-2,4-dien-1-yl)oxetane (PubChem CID 175208692) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 2,2-dimethyl-3-(6-phenylcyclohexa-2,4-dien-1-yl)oxetane.
| Compound Name | 2,2-dimethyl-3-(6-phenylcyclohexa-2,4-dien-1-yl)oxetane |
|---|---|
| PubChem CID | 175208692 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2,2-dimethyl-3-(6-phenylcyclohexa-2,4-dien-1-yl)oxetane |
| SMILES | CC1(C)OCC1C1C=CC=CC1c1ccccc1 |
| InChI | InChI=1S/C17H20O/c1-17(2)16(12-18-17)15-11-7-6-10-14(15)13-8-4-3-5-9-13/h3-11,14-16H,12H2,1-2H3 |
| InChIKey | DWEGKGYAPUBWDD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |