C19H23N2O+ — CID 7336324
2-[(6R)-2,2-dimethyl-4-(4-methylphenyl)-5,6-dihydro-1H-pyrimidin-1-ium-6-yl]phenol (PubChem CID 7336324) has the molecular formula C19H23N2O+ and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-[(6R)-2,2-dimethyl-4-(4-methylphenyl)-5,6-dihydro-1H-pyrimidin-1-ium-6-yl]phenol.
| Compound Name | 2-[(6R)-2,2-dimethyl-4-(4-methylphenyl)-5,6-dihydro-1H-pyrimidin-1-ium-6-yl]phenol |
|---|---|
| PubChem CID | 7336324 |
| Molecular Formula | C19H23N2O+ |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[(6R)-2,2-dimethyl-4-(4-methylphenyl)-5,6-dihydro-1H-pyrimidin-1-ium-6-yl]phenol |
| SMILES | Cc1ccc(C2=NC(C)(C)[NH2+][C@@H](c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C19H22N2O/c1-13-8-10-14(11-9-13)16-12-17(21-19(2,3)20-16)15-6-4-5-7-18(15)22/h4-11,17,21-22H,12H2,1-3H3/p+1/t17-/m1/s1 |
| InChIKey | CVUDKDYDXRFYAB-QGZVFWFLSA-O |
| XLogP | 2.93 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|