C20H25N2O2+ — CID 7308988
2-[(2S,6R)-4-(4-methoxyphenyl)-2-propyl-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol (PubChem CID 7308988) has the molecular formula C20H25N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[(2S,6R)-4-(4-methoxyphenyl)-2-propyl-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol.
| Compound Name | 2-[(2S,6R)-4-(4-methoxyphenyl)-2-propyl-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol |
|---|---|
| PubChem CID | 7308988 |
| Molecular Formula | C20H25N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-[(2S,6R)-4-(4-methoxyphenyl)-2-propyl-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol |
| SMILES | CCC[C@@H]1N=C(c2ccc(OC)cc2)C[C@H](c2ccccc2O)[NH2+]1 |
| InChI | InChI=1S/C20H24N2O2/c1-3-6-20-21-17(14-9-11-15(24-2)12-10-14)13-18(22-20)16-7-4-5-8-19(16)23/h4-5,7-12,18,20,22-23H,3,6,13H2,1-2H3/p+1/t18-,20-/m1/s1 |
| InChIKey | UUOZRNLRVQKZFI-UYAOXDASSA-O |
| XLogP | 3.02 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|