C20H19N2OS+ — CID 7462247
2-[(2S,6S)-4-phenyl-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol (PubChem CID 7462247) has the molecular formula C20H19N2OS+ and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(2S,6S)-4-phenyl-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol.
| Compound Name | 2-[(2S,6S)-4-phenyl-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol |
|---|---|
| PubChem CID | 7462247 |
| Molecular Formula | C20H19N2OS+ |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(2S,6S)-4-phenyl-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol |
| SMILES | Oc1ccccc1[C@@H]1CC(c2ccccc2)=N[C@@H](c2cccs2)[NH2+]1 |
| InChI | InChI=1S/C20H18N2OS/c23-18-10-5-4-9-15(18)17-13-16(14-7-2-1-3-8-14)21-20(22-17)19-11-6-12-24-19/h1-12,17,20,22-23H,13H2/p+1/t17-,20+/m0/s1 |
| InChIKey | FPSQVQJUODRHBS-FXAWDEMLSA-O |
| XLogP | 3.65 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|