C23H22FN2O2+ — CID 7336211
2-[(2R,6S)-2-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol (PubChem CID 7336211) has the molecular formula C23H22FN2O2+ and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[(2R,6S)-2-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol.
| Compound Name | 2-[(2R,6S)-2-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol |
|---|---|
| PubChem CID | 7336211 |
| Molecular Formula | C23H22FN2O2+ |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[(2R,6S)-2-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-1-ium-6-yl]phenol |
| SMILES | COc1ccc(C2=N[C@H](c3ccc(F)cc3)[NH2+][C@H](c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C23H21FN2O2/c1-28-18-12-8-15(9-13-18)20-14-21(19-4-2-3-5-22(19)27)26-23(25-20)16-6-10-17(24)11-7-16/h2-13,21,23,26-27H,14H2,1H3/p+1/t21-,23-/m0/s1 |
| InChIKey | XBGZCNYTTMYKJR-GMAHTHKFSA-O |
| XLogP | 3.74 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|