C21H22ClN2O2+ — CID 73370018
1-[(4-chlorophenyl)methyl]-3-cyclohexyl-4aH-quinazolin-1-ium-2,4-dione (PubChem CID 73370018) has the molecular formula C21H22ClN2O2+ and a molecular weight of 369.87 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-cyclohexyl-4aH-quinazolin-1-ium-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-cyclohexyl-4aH-quinazolin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73370018 |
| Molecular Formula | C21H22ClN2O2+ |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-cyclohexyl-4aH-quinazolin-1-ium-2,4-dione |
| SMILES | O=C1C2C=CC=CC2=[N+](Cc2ccc(Cl)cc2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C21H22ClN2O2/c22-16-12-10-15(11-13-16)14-23-19-9-5-4-8-18(19)20(25)24(21(23)26)17-6-2-1-3-7-17/h4-5,8-13,17-18H,1-3,6-7,14H2/q+1 |
| InChIKey | QPOAVCUWMFRMHJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|