C17H19N3O5 — CID 7340067
ethyl 2-[(2S)-1-[(2,3-dioxoindol-1-yl)methyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 7340067) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is ethyl 2-[(2S)-1-[(2,3-dioxoindol-1-yl)methyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S)-1-[(2,3-dioxoindol-1-yl)methyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 7340067 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | ethyl 2-[(2S)-1-[(2,3-dioxoindol-1-yl)methyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C(=O)NCCN1CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H19N3O5/c1-2-25-14(21)9-13-16(23)18-7-8-19(13)10-20-12-6-4-3-5-11(12)15(22)17(20)24/h3-6,13H,2,7-10H2,1H3,(H,18,23)/t13-/m0/s1 |
| InChIKey | YZKQANGSRUZMDW-ZDUSSCGKSA-N |
| XLogP | -0.07 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|