C4H5N5O4 — CID 7340165
(3aR,6aS)-4-nitro-3,3a,6,6a-tetrahydro-1H-imidazo[4,5-d]imidazole-2,5-dione (PubChem CID 7340165) has the molecular formula C4H5N5O4 and a molecular weight of 187.12 g/mol. Its IUPAC name is (3aR,6aS)-4-nitro-3,3a,6,6a-tetrahydro-1H-imidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | (3aR,6aS)-4-nitro-3,3a,6,6a-tetrahydro-1H-imidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 7340165 |
| Molecular Formula | C4H5N5O4 |
| Molecular Weight | 187.12 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | (3aR,6aS)-4-nitro-3,3a,6,6a-tetrahydro-1H-imidazo[4,5-d]imidazole-2,5-dione |
| SMILES | O=C1N[C@H]2NC(=O)N([N+](=O)[O-])[C@H]2N1 |
| InChI | InChI=1S/C4H5N5O4/c10-3-5-1-2(7-3)8(9(12)13)4(11)6-1/h1-2H,(H,6,11)(H2,5,7,10)/t1-,2+/m0/s1 |
| InChIKey | JKHUCXGVGAGENO-NHYDCYSISA-N |
| XLogP | -1.83 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.12 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|