C3H4N4O7 — CID 11160074
4,5-dihydroxy-1,3-dinitroimidazolidin-2-one (PubChem CID 11160074) has the molecular formula C3H4N4O7 and a molecular weight of 208.09 g/mol. Its IUPAC name is 4,5-dihydroxy-1,3-dinitroimidazolidin-2-one.
| Compound Name | 4,5-dihydroxy-1,3-dinitroimidazolidin-2-one |
|---|---|
| PubChem CID | 11160074 |
| Molecular Formula | C3H4N4O7 |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 4,5-dihydroxy-1,3-dinitroimidazolidin-2-one |
| SMILES | O=C1N([N+](=O)[O-])C(O)C(O)N1[N+](=O)[O-] |
| InChI | InChI=1S/C3H4N4O7/c8-1-2(9)5(7(13)14)3(10)4(1)6(11)12/h1-2,8-9H |
| InChIKey | VSLSIZGAOJLVBQ-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|