C13H14N2O4S — CID 7340231
methyl (2R,3E,4S)-4-benzamido-3-hydroxyiminothiolane-2-carboxylate (PubChem CID 7340231) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is methyl (2R,3E,4S)-4-benzamido-3-hydroxyiminothiolane-2-carboxylate.
| Compound Name | methyl (2R,3E,4S)-4-benzamido-3-hydroxyiminothiolane-2-carboxylate |
|---|---|
| PubChem CID | 7340231 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | methyl (2R,3E,4S)-4-benzamido-3-hydroxyiminothiolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1SC[C@@H](NC(=O)c2ccccc2)/C1=N\O |
| InChI | InChI=1S/C13H14N2O4S/c1-19-13(17)11-10(15-18)9(7-20-11)14-12(16)8-5-3-2-4-6-8/h2-6,9,11,18H,7H2,1H3,(H,14,16)/b15-10+/t9-,11-/m1/s1 |
| InChIKey | FRCGNIIRRCRTOP-GEWJIIEGSA-N |
| XLogP | 0.90 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|