C9H10BrF2NO — CID 73407272
1-(6-bromo-2,3-difluorophenoxy)propan-2-amine (PubChem CID 73407272) has the molecular formula C9H10BrF2NO and a molecular weight of 266.08 g/mol. Its IUPAC name is 1-(6-bromo-2,3-difluorophenoxy)propan-2-amine.
| Compound Name | 1-(6-bromo-2,3-difluorophenoxy)propan-2-amine |
|---|---|
| PubChem CID | 73407272 |
| Molecular Formula | C9H10BrF2NO |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 1-(6-bromo-2,3-difluorophenoxy)propan-2-amine |
| SMILES | CC(N)COc1c(Br)ccc(F)c1F |
| InChI | InChI=1S/C9H10BrF2NO/c1-5(13)4-14-9-6(10)2-3-7(11)8(9)12/h2-3,5H,4,13H2,1H3 |
| InChIKey | FQYAZMQDZJNMPK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|