C14H15Cl2F3O3 — CID 73412517
2-chloro-4-[4-(3-chloro-4,4,4-trifluorobut-2-enoxy)butoxy]phenol (PubChem CID 73412517) has the molecular formula C14H15Cl2F3O3 and a molecular weight of 359.17 g/mol. Its IUPAC name is 2-chloro-4-[4-(3-chloro-4,4,4-trifluorobut-2-enoxy)butoxy]phenol.
| Compound Name | 2-chloro-4-[4-(3-chloro-4,4,4-trifluorobut-2-enoxy)butoxy]phenol |
|---|---|
| PubChem CID | 73412517 |
| Molecular Formula | C14H15Cl2F3O3 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-chloro-4-[4-(3-chloro-4,4,4-trifluorobut-2-enoxy)butoxy]phenol |
| SMILES | Oc1ccc(OCCCCOCC=C(Cl)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H15Cl2F3O3/c15-11-9-10(3-4-12(11)20)22-7-2-1-6-21-8-5-13(16)14(17,18)19/h3-5,9,20H,1-2,6-8H2 |
| InChIKey | BIFKTKVIYNNKLS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|