About 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one
4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one (PubChem CID 73441258) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one.
Molecular Properties
| Compound Name | 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one |
| PubChem CID | 73441258 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one |
| SMILES | CC1=CC2C3COC2(c2ccccc2)C(C)(C3)C1=O |
| InChI | InChI=1S/C17H18O2/c1-11-8-14-12-9-16(2,15(11)18)17(14,19-10-12)13-6-4-3-5-7-13/h3-8,12,14H,9-10H2,1-2H3 |
| InChIKey | SQSHIQIXTHZCLS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one?
The IUPAC name of 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one (CID 73441258) is 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one.
What is the SMILES notation for 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one?
The canonical SMILES for 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one is CC1=CC2C3COC2(c2ccccc2)C(C)(C3)C1=O.
What is the InChIKey of 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one?
The InChIKey is SQSHIQIXTHZCLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2/c1-11-8-14-12-9-16(2,15(11)18)17(14,19-10-12)13-6-4-3-5-7-13/h3-8,12,14H,9-10H2,1-2H3.
What are the key properties of 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one?
4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one has a molecular weight of 254.33 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1-phenyl-10-oxatricyclo[4.4.0.02,8]dec-3-en-5-one is sourced from PubChem (CID 73441258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).