C22H20O2 — CID 101414819
(1R,6R)-1,4-dimethyl-8,8-diphenylbicyclo[4.2.0]oct-3-ene-2,5-dione (PubChem CID 101414819) has the molecular formula C22H20O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is (1R,6R)-1,4-dimethyl-8,8-diphenylbicyclo[4.2.0]oct-3-ene-2,5-dione.
| Compound Name | (1R,6R)-1,4-dimethyl-8,8-diphenylbicyclo[4.2.0]oct-3-ene-2,5-dione |
|---|---|
| PubChem CID | 101414819 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1R,6R)-1,4-dimethyl-8,8-diphenylbicyclo[4.2.0]oct-3-ene-2,5-dione |
| SMILES | CC1=CC(=O)[C@]2(C)[C@@H](CC2(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C22H20O2/c1-15-13-19(23)21(2)18(20(15)24)14-22(21,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13,18H,14H2,1-2H3/t18-,21-/m0/s1 |
| InChIKey | PPGPITRNOKZHPV-RXVVDRJESA-N |
| XLogP | 4.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |