C18H25FN4O2S — CID 73450505
5-butan-2-ylsulfanyl-7-(4-fluorophenyl)-1,3-dimethyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 73450505) has the molecular formula C18H25FN4O2S and a molecular weight of 380.49 g/mol. Its IUPAC name is 5-butan-2-ylsulfanyl-7-(4-fluorophenyl)-1,3-dimethyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 5-butan-2-ylsulfanyl-7-(4-fluorophenyl)-1,3-dimethyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 73450505 |
| Molecular Formula | C18H25FN4O2S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 5-butan-2-ylsulfanyl-7-(4-fluorophenyl)-1,3-dimethyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | CCC(C)SC1NC(c2ccc(F)cc2)NC2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H25FN4O2S/c1-5-10(2)26-16-13-15(22(3)18(25)23(4)17(13)24)20-14(21-16)11-6-8-12(19)9-7-11/h6-10,13-16,20-21H,5H2,1-4H3 |
| InChIKey | WPWWHQMAQKGHNC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |