C19H21N4O4+ — CID 73451428
2-(5-ethoxy-1-methyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-3-yl)-N-(2-methylphenyl)acetamide (PubChem CID 73451428) has the molecular formula C19H21N4O4+ and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(5-ethoxy-1-methyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-3-yl)-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(5-ethoxy-1-methyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-3-yl)-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 73451428 |
| Molecular Formula | C19H21N4O4+ |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-(5-ethoxy-1-methyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-3-yl)-N-(2-methylphenyl)acetamide |
| SMILES | CCOC1=CC=NC2=[N+](C)C(=O)N(CC(=O)Nc3ccccc3C)C(=O)C12 |
| InChI | InChI=1S/C19H20N4O4/c1-4-27-14-9-10-20-17-16(14)18(25)23(19(26)22(17)3)11-15(24)21-13-8-6-5-7-12(13)2/h5-10,16H,4,11H2,1-3H3/p+1 |
| InChIKey | RNOXFZUWESTOIG-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|