C16H18N3O4S+ — CID 7348794
(2Z)-2-[3-(morpholin-4-ium-4-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]-N-phenylacetamide (PubChem CID 7348794) has the molecular formula C16H18N3O4S+ and a molecular weight of 348.40 g/mol. Its IUPAC name is (2Z)-2-[3-(morpholin-4-ium-4-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]-N-phenylacetamide.
| Compound Name | (2Z)-2-[3-(morpholin-4-ium-4-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]-N-phenylacetamide |
|---|---|
| PubChem CID | 7348794 |
| Molecular Formula | C16H18N3O4S+ |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2Z)-2-[3-(morpholin-4-ium-4-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]-N-phenylacetamide |
| SMILES | O=C(/C=C1\SC(=O)N(C[NH+]2CCOCC2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H17N3O4S/c20-14(17-12-4-2-1-3-5-12)10-13-15(21)19(16(22)24-13)11-18-6-8-23-9-7-18/h1-5,10H,6-9,11H2,(H,17,20)/p+1/b13-10- |
| InChIKey | JJEVMGYBDOQENT-RAXLEYEMSA-O |
| XLogP | 0.08 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|