C15H15N2O5- — CID 7349040
(1S,6S)-4-methyl-6-[(4-nitrophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7349040) has the molecular formula C15H15N2O5- and a molecular weight of 303.29 g/mol. Its IUPAC name is (1S,6S)-4-methyl-6-[(4-nitrophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-4-methyl-6-[(4-nitrophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7349040 |
| Molecular Formula | C15H15N2O5- |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (1S,6S)-4-methyl-6-[(4-nitrophenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC1=CC[C@H](C(=O)[O-])[C@@H](C(=O)Nc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C15H16N2O5/c1-9-2-7-12(15(19)20)13(8-9)14(18)16-10-3-5-11(6-4-10)17(21)22/h2-6,12-13H,7-8H2,1H3,(H,16,18)(H,19,20)/p-1/t12-,13-/m0/s1 |
| InChIKey | JPZYMRHSACSPHH-STQMWFEESA-M |
| XLogP | 1.26 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|