About tert-butyl N-phenylmethoxycarbamate
tert-butyl N-phenylmethoxycarbamate (PubChem CID 736159) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is tert-butyl N-phenylmethoxycarbamate.
Molecular Properties
| Compound Name | tert-butyl N-phenylmethoxycarbamate |
| PubChem CID | 736159 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | tert-butyl N-phenylmethoxycarbamate |
| SMILES | CC(C)(C)OC(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C12H17NO3/c1-12(2,3)16-11(14)13-15-9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,13,14) |
| InChIKey | MZNBNPWFHGWAGH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-phenylmethoxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-phenylmethoxycarbamate?
The IUPAC name of tert-butyl N-phenylmethoxycarbamate (CID 736159) is tert-butyl N-phenylmethoxycarbamate.
What is the SMILES notation for tert-butyl N-phenylmethoxycarbamate?
The canonical SMILES for tert-butyl N-phenylmethoxycarbamate is CC(C)(C)OC(=O)NOCc1ccccc1.
What is the InChIKey of tert-butyl N-phenylmethoxycarbamate?
The InChIKey is MZNBNPWFHGWAGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-12(2,3)16-11(14)13-15-9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,13,14).
What are the key properties of tert-butyl N-phenylmethoxycarbamate?
tert-butyl N-phenylmethoxycarbamate has a molecular weight of 223.27 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-phenylmethoxycarbamate is sourced from PubChem (CID 736159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).