C14H24N4O2S — CID 7367049
5-[3-(dimethylamino)propyliminomethyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7367049) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyliminomethyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[3-(dimethylamino)propyliminomethyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7367049 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-[3-(dimethylamino)propyliminomethyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(/C=N/CCCN(C)C)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C14H24N4O2S/c1-5-17-12(19)11(10-15-8-7-9-16(3)4)13(20)18(6-2)14(17)21/h10-11H,5-9H2,1-4H3/b15-10+ |
| InChIKey | ZNNWUYXWNMODIO-XNTDXEJSSA-N |
| XLogP | 0.62 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|