C17H29N5O3 — CID 7367328
(5S)-1-hexyl-5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7367328) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (5S)-1-hexyl-5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-hexyl-5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367328 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (5S)-1-hexyl-5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCN1C(=O)NC(=O)[C@H](/C=N/CCN2CCNCC2)C1=O |
| InChI | InChI=1S/C17H29N5O3/c1-2-3-4-5-9-22-16(24)14(15(23)20-17(22)25)13-19-8-12-21-10-6-18-7-11-21/h13-14,18H,2-12H2,1H3,(H,20,23,25)/b19-13+/t14-/m0/s1 |
| InChIKey | OOZPDLNDAVANQP-ITRAFESCSA-N |
| XLogP | 0.24 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|