C13H23N4O3+ — CID 7369450
2-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]ethyl-dimethylazanium (PubChem CID 7369450) has the molecular formula C13H23N4O3+ and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]ethyl-dimethylazanium.
| Compound Name | 2-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7369450 |
| Molecular Formula | C13H23N4O3+ |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]ethyl-dimethylazanium |
| SMILES | CC/C(=N\CC[NH+](C)C)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H22N4O3/c1-6-9(14-7-8-15(2)3)10-11(18)16(4)13(20)17(5)12(10)19/h10H,6-8H2,1-5H3/p+1/b14-9+ |
| InChIKey | CRAWBYYADASBND-NTEUORMPSA-O |
| XLogP | -1.35 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|