C14H14N3O3+ — CID 7377471
(3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxy-4-methylpent-1-ene-1-diazonium (PubChem CID 7377471) has the molecular formula C14H14N3O3+ and a molecular weight of 272.28 g/mol. Its IUPAC name is (3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxy-4-methylpent-1-ene-1-diazonium.
| Compound Name | (3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxy-4-methylpent-1-ene-1-diazonium |
|---|---|
| PubChem CID | 7377471 |
| Molecular Formula | C14H14N3O3+ |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxy-4-methylpent-1-ene-1-diazonium |
| SMILES | CC(C)[C@@H](C(O)=C[N+]#N)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H13N3O3/c1-8(2)12(11(18)7-16-15)17-13(19)9-5-3-4-6-10(9)14(17)20/h3-8,12H,1-2H3/p+1/t12-/m0/s1 |
| InChIKey | WDJBRBCUWNGFRG-LBPRGKRZSA-O |
| XLogP | 2.56 |
| TPSA | 85.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|