C18H17Cl2NO — CID 7377775
[(2S,3R,4R)-3,4-dichloro-2,6-dimethyl-3,4-dihydro-2H-quinolin-1-yl]-phenylmethanone (PubChem CID 7377775) has the molecular formula C18H17Cl2NO and a molecular weight of 334.25 g/mol. Its IUPAC name is [(2S,3R,4R)-3,4-dichloro-2,6-dimethyl-3,4-dihydro-2H-quinolin-1-yl]-phenylmethanone.
| Compound Name | [(2S,3R,4R)-3,4-dichloro-2,6-dimethyl-3,4-dihydro-2H-quinolin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7377775 |
| Molecular Formula | C18H17Cl2NO |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | [(2S,3R,4R)-3,4-dichloro-2,6-dimethyl-3,4-dihydro-2H-quinolin-1-yl]-phenylmethanone |
| SMILES | Cc1ccc2c(c1)[C@@H](Cl)[C@H](Cl)[C@H](C)N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17Cl2NO/c1-11-8-9-15-14(10-11)17(20)16(19)12(2)21(15)18(22)13-6-4-3-5-7-13/h3-10,12,16-17H,1-2H3/t12-,16+,17+/m0/s1 |
| InChIKey | MOYBLVBLCSVNJJ-JCURWCKSSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|