C20H29ClN6+2 — CID 7383925
1-[(S)-(2-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]-4-prop-2-enylpiperazine-1,4-diium (PubChem CID 7383925) has the molecular formula C20H29ClN6+2 and a molecular weight of 388.95 g/mol. Its IUPAC name is 1-[(S)-(2-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]-4-prop-2-enylpiperazine-1,4-diium.
| Compound Name | 1-[(S)-(2-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]-4-prop-2-enylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7383925 |
| Molecular Formula | C20H29ClN6+2 |
| Molecular Weight | 388.95 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1-[(S)-(2-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]-4-prop-2-enylpiperazine-1,4-diium |
| SMILES | C=CC[NH+]1CC[NH+]([C@@H](c2ccccc2Cl)c2nnnn2C2CCCC2)CC1 |
| InChI | InChI=1S/C20H27ClN6/c1-2-11-25-12-14-26(15-13-25)19(17-9-5-6-10-18(17)21)20-22-23-24-27(20)16-7-3-4-8-16/h2,5-6,9-10,16,19H,1,3-4,7-8,11-15H2/p+2/t19-/m0/s1 |
| InChIKey | ZLWCIFYMJFAIMS-IBGZPJMESA-P |
| XLogP | 0.50 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.95 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|