C21H32N6O+2 — CID 7383893
1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-prop-2-enylpiperazine-1,4-diium (PubChem CID 7383893) has the molecular formula C21H32N6O+2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-prop-2-enylpiperazine-1,4-diium.
| Compound Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-prop-2-enylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7383893 |
| Molecular Formula | C21H32N6O+2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(2-methoxyphenyl)methyl]-4-prop-2-enylpiperazine-1,4-diium |
| SMILES | C=CC[NH+]1CC[NH+]([C@@H](c2ccccc2OC)c2nnnn2C2CCCC2)CC1 |
| InChI | InChI=1S/C21H30N6O/c1-3-12-25-13-15-26(16-14-25)20(18-10-6-7-11-19(18)28-2)21-22-23-24-27(21)17-8-4-5-9-17/h3,6-7,10-11,17,20H,1,4-5,8-9,12-16H2,2H3/p+2/t20-/m0/s1 |
| InChIKey | CGDVPEFGLBQQJL-FQEVSTJZSA-P |
| XLogP | -0.14 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|