C21H31ClN6+2 — CID 7383695
1-[(S)-(2-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-4-prop-2-enylpiperazine-1,4-diium (PubChem CID 7383695) has the molecular formula C21H31ClN6+2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 1-[(S)-(2-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-4-prop-2-enylpiperazine-1,4-diium.
| Compound Name | 1-[(S)-(2-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-4-prop-2-enylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7383695 |
| Molecular Formula | C21H31ClN6+2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-[(S)-(2-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-4-prop-2-enylpiperazine-1,4-diium |
| SMILES | C=CC[NH+]1CC[NH+]([C@@H](c2ccccc2Cl)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H29ClN6/c1-2-12-26-13-15-27(16-14-26)20(18-10-6-7-11-19(18)22)21-23-24-25-28(21)17-8-4-3-5-9-17/h2,6-7,10-11,17,20H,1,3-5,8-9,12-16H2/p+2/t20-/m0/s1 |
| InChIKey | MRDVEIYTNVENGR-FQEVSTJZSA-P |
| XLogP | 0.89 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|