C23H22N2O4S — CID 74005298
2-morpholin-4-ylethyl 4-[3-(1,3-benzothiazol-2-yl)-3-oxoprop-1-enyl]benzoate (PubChem CID 74005298) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 4-[3-(1,3-benzothiazol-2-yl)-3-oxoprop-1-enyl]benzoate.
| Compound Name | 2-morpholin-4-ylethyl 4-[3-(1,3-benzothiazol-2-yl)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 74005298 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-morpholin-4-ylethyl 4-[3-(1,3-benzothiazol-2-yl)-3-oxoprop-1-enyl]benzoate |
| SMILES | O=C(OCCN1CCOCC1)c1ccc(C=CC(=O)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c26-20(22-24-19-3-1-2-4-21(19)30-22)10-7-17-5-8-18(9-6-17)23(27)29-16-13-25-11-14-28-15-12-25/h1-10H,11-16H2 |
| InChIKey | WCYYKYPNGNPPJP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|