C23H25FN2O8 — CID 74006960
2-ethylbutyl 3-[3-[(4-fluoro-2,6-dinitrophenyl)methoxy]-4-methoxyphenyl]prop-2-enoate (PubChem CID 74006960) has the molecular formula C23H25FN2O8 and a molecular weight of 476.46 g/mol. Its IUPAC name is 2-ethylbutyl 3-[3-[(4-fluoro-2,6-dinitrophenyl)methoxy]-4-methoxyphenyl]prop-2-enoate.
| Compound Name | 2-ethylbutyl 3-[3-[(4-fluoro-2,6-dinitrophenyl)methoxy]-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 74006960 |
| Molecular Formula | C23H25FN2O8 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-ethylbutyl 3-[3-[(4-fluoro-2,6-dinitrophenyl)methoxy]-4-methoxyphenyl]prop-2-enoate |
| SMILES | CCC(CC)COC(=O)C=Cc1ccc(OC)c(OCc2c([N+](=O)[O-])cc(F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25FN2O8/c1-4-15(5-2)13-34-23(27)9-7-16-6-8-21(32-3)22(10-16)33-14-18-19(25(28)29)11-17(24)12-20(18)26(30)31/h6-12,15H,4-5,13-14H2,1-3H3 |
| InChIKey | OMNPZKCSRMTMIM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|