C19H21N4O+ — CID 7402621
N-[2-[(3,6-dimethylquinolin-1-ium-2-yl)amino]ethyl]pyridine-4-carboxamide (PubChem CID 7402621) has the molecular formula C19H21N4O+ and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[2-[(3,6-dimethylquinolin-1-ium-2-yl)amino]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[(3,6-dimethylquinolin-1-ium-2-yl)amino]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 7402621 |
| Molecular Formula | C19H21N4O+ |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[2-[(3,6-dimethylquinolin-1-ium-2-yl)amino]ethyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc2[nH+]c(NCCNC(=O)c3ccncc3)c(C)cc2c1 |
| InChI | InChI=1S/C19H20N4O/c1-13-3-4-17-16(11-13)12-14(2)18(23-17)21-9-10-22-19(24)15-5-7-20-8-6-15/h3-8,11-12H,9-10H2,1-2H3,(H,21,23)(H,22,24)/p+1 |
| InChIKey | HYNCAMOVAMNPOD-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|