C25H29N4O+ — CID 7434746
4-tert-butyl-N-[2-[(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)amino]ethyl]benzamide (PubChem CID 7434746) has the molecular formula C25H29N4O+ and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)amino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 7434746 |
| Molecular Formula | C25H29N4O+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 4-tert-butyl-N-[2-[(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCNC(=O)c3ccc(C(C)(C)C)cc3)[nH+]c2c1 |
| InChI | InChI=1S/C25H28N4O/c1-16-12-17(2)21-14-19(15-26)23(29-22(21)13-16)27-10-11-28-24(30)18-6-8-20(9-7-18)25(3,4)5/h6-9,12-14H,10-11H2,1-5H3,(H,27,29)(H,28,30)/p+1 |
| InChIKey | GAFMEOMPVDBYKO-UHFFFAOYSA-O |
| XLogP | 4.28 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|