C17H21N4O+ — CID 7434760
N-[2-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]ethyl]propanamide (PubChem CID 7434760) has the molecular formula C17H21N4O+ and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[2-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]ethyl]propanamide.
| Compound Name | N-[2-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 7434760 |
| Molecular Formula | C17H21N4O+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[2-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]ethyl]propanamide |
| SMILES | CCC(=O)NCCNc1[nH+]c2c(C)c(C)ccc2cc1C#N |
| InChI | InChI=1S/C17H20N4O/c1-4-15(22)19-7-8-20-17-14(10-18)9-13-6-5-11(2)12(3)16(13)21-17/h5-6,9H,4,7-8H2,1-3H3,(H,19,22)(H,20,21)/p+1 |
| InChIKey | OXYNLJUIEIWJIU-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|