C17H21N4O+ — CID 7434764
N-[3-[(3-cyano-8-methylquinolin-1-ium-2-yl)amino]propyl]propanamide (PubChem CID 7434764) has the molecular formula C17H21N4O+ and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[3-[(3-cyano-8-methylquinolin-1-ium-2-yl)amino]propyl]propanamide.
| Compound Name | N-[3-[(3-cyano-8-methylquinolin-1-ium-2-yl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 7434764 |
| Molecular Formula | C17H21N4O+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[3-[(3-cyano-8-methylquinolin-1-ium-2-yl)amino]propyl]propanamide |
| SMILES | CCC(=O)NCCCNc1[nH+]c2c(C)cccc2cc1C#N |
| InChI | InChI=1S/C17H20N4O/c1-3-15(22)19-8-5-9-20-17-14(11-18)10-13-7-4-6-12(2)16(13)21-17/h4,6-7,10H,3,5,8-9H2,1-2H3,(H,19,22)(H,20,21)/p+1 |
| InChIKey | SEONXVBLGCGMKL-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|