C20H28N5OS+ — CID 7434681
1-[2-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]ethyl]-3-(3-ethoxypropyl)thiourea (PubChem CID 7434681) has the molecular formula C20H28N5OS+ and a molecular weight of 386.55 g/mol. Its IUPAC name is 1-[2-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]ethyl]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[2-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]ethyl]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 7434681 |
| Molecular Formula | C20H28N5OS+ |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[2-[(3-cyano-7,8-dimethylquinolin-1-ium-2-yl)amino]ethyl]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)NCCNc1[nH+]c2c(C)c(C)ccc2cc1C#N |
| InChI | InChI=1S/C20H27N5OS/c1-4-26-11-5-8-23-20(27)24-10-9-22-19-17(13-21)12-16-7-6-14(2)15(3)18(16)25-19/h6-7,12H,4-5,8-11H2,1-3H3,(H,22,25)(H2,23,24,27)/p+1 |
| InChIKey | RRIVGDJRHHMMKV-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|