C17H22N5S+ — CID 7421154
1-[3-[(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)amino]propyl]-3-methylthiourea (PubChem CID 7421154) has the molecular formula C17H22N5S+ and a molecular weight of 328.47 g/mol. Its IUPAC name is 1-[3-[(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)amino]propyl]-3-methylthiourea.
| Compound Name | 1-[3-[(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)amino]propyl]-3-methylthiourea |
|---|---|
| PubChem CID | 7421154 |
| Molecular Formula | C17H22N5S+ |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[3-[(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)amino]propyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCCNc1[nH+]c2cc(C)cc(C)c2cc1C#N |
| InChI | InChI=1S/C17H21N5S/c1-11-7-12(2)14-9-13(10-18)16(22-15(14)8-11)20-5-4-6-21-17(23)19-3/h7-9H,4-6H2,1-3H3,(H,20,22)(H2,19,21,23)/p+1 |
| InChIKey | PVQASQDCGZFPPM-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|